C23H41N3 — CID 10570471
1,3-bis[(2E)-3,7-dimethylocta-2,6-dienyl]-1,3-dimethylguanidine (PubChem CID 10570471) has the molecular formula C23H41N3 and a molecular weight of 359.60 g/mol. Its IUPAC name is 1,3-bis[(2E)-3,7-dimethylocta-2,6-dienyl]-1,3-dimethylguanidine.
| Compound Name | 1,3-bis[(2E)-3,7-dimethylocta-2,6-dienyl]-1,3-dimethylguanidine |
|---|---|
| PubChem CID | 10570471 |
| Molecular Formula | C23H41N3 |
| Molecular Weight | 359.60 g/mol |
| Exact Mass | 359.33 |
| IUPAC Name | 1,3-bis[(2E)-3,7-dimethylocta-2,6-dienyl]-1,3-dimethylguanidine |
| SMILES | [H]N=C(N(C)C/C=C(\C)CCC=C(C)C)N(C)C/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C23H41N3/c1-19(2)11-9-13-21(5)15-17-25(7)23(24)26(8)18-16-22(6)14-10-12-20(3)4/h11-12,15-16,24H,9-10,13-14,17-18H2,1-8H3/b21-15+,22-16+ |
| InChIKey | NQJSPBXUQXWVRB-YHARCJFQSA-N |
| XLogP | 6.17 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.60 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|