C16H29NO6Si — CID 10570527
(2R)-2-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-3-methoxy-2-methyl-3-oxo(113C)propanoic acid (PubChem CID 10570527) has the molecular formula C16H29NO6Si and a molecular weight of 360.49 g/mol. Its IUPAC name is (2R)-2-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-3-methoxy-2-methyl-3-oxo(113C)propanoic acid.
| Compound Name | (2R)-2-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-3-methoxy-2-methyl-3-oxo(113C)propanoic acid |
|---|---|
| PubChem CID | 10570527 |
| Molecular Formula | C16H29NO6Si |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | (2R)-2-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-3-methoxy-2-methyl-3-oxo(113C)propanoic acid |
| SMILES | COC(=O)[C@](C)([C@H]1NC(=O)[C@@H]1[C@@H](C)O[Si](C)(C)C(C)(C)C)[13C](=O)O |
| InChI | InChI=1S/C16H29NO6Si/c1-9(23-24(7,8)15(2,3)4)10-11(17-12(10)18)16(5,13(19)20)14(21)22-6/h9-11H,1-8H3,(H,17,18)(H,19,20)/t9-,10-,11+,16-/m1/s1/i13+1 |
| InChIKey | BTHJITIHVNSXGZ-MXHAHISSSA-N |
| XLogP | 1.78 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|