C19H27NO6 — CID 10570850
4-[(2R,4aR,6R,7S,8R,8aS)-6,7-dimethoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]morpholine (PubChem CID 10570850) has the molecular formula C19H27NO6 and a molecular weight of 365.43 g/mol. Its IUPAC name is 4-[(2R,4aR,6R,7S,8R,8aS)-6,7-dimethoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]morpholine.
| Compound Name | 4-[(2R,4aR,6R,7S,8R,8aS)-6,7-dimethoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]morpholine |
|---|---|
| PubChem CID | 10570850 |
| Molecular Formula | C19H27NO6 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | 4-[(2R,4aR,6R,7S,8R,8aS)-6,7-dimethoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]morpholine |
| SMILES | CO[C@@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@@H](N2CCOCC2)[C@@H]1OC |
| InChI | InChI=1S/C19H27NO6/c1-21-17-15(20-8-10-23-11-9-20)16-14(25-19(17)22-2)12-24-18(26-16)13-6-4-3-5-7-13/h3-7,14-19H,8-12H2,1-2H3/t14-,15-,16-,17+,18-,19-/m1/s1 |
| InChIKey | SGWONSNMODANAP-WVXCVLBUSA-N |
| XLogP | 1.19 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |