C24H31NO2 — CID 10570870
(3R)-1-(6,6-diphenylhexyl)piperidine-3-carboxylic acid (PubChem CID 10570870) has the molecular formula C24H31NO2 and a molecular weight of 365.52 g/mol. Its IUPAC name is (3R)-1-(6,6-diphenylhexyl)piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-(6,6-diphenylhexyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 10570870 |
| Molecular Formula | C24H31NO2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | (3R)-1-(6,6-diphenylhexyl)piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN(CCCCCC(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C24H31NO2/c26-24(27)22-15-10-18-25(19-22)17-9-3-8-16-23(20-11-4-1-5-12-20)21-13-6-2-7-14-21/h1-2,4-7,11-14,22-23H,3,8-10,15-19H2,(H,26,27)/t22-/m1/s1 |
| InChIKey | LGDYFOYHSZGDEU-JOCHJYFZSA-N |
| XLogP | 5.18 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|