C17H22N10 — CID 10570921
N-[(E)-[2-[(E)-(1,4,5,6-tetrahydropyrimidin-2-ylhydrazinylidene)methyl]imidazo[1,2-a]pyridin-6-yl]methylideneamino]-1,4,5,6-tetrahydropyrimidin-2-amine (PubChem CID 10570921) has the molecular formula C17H22N10 and a molecular weight of 366.43 g/mol. Its IUPAC name is N-[(E)-[2-[(E)-(1,4,5,6-tetrahydropyrimidin-2-ylhydrazinylidene)methyl]imidazo[1,2-a]pyridin-6-yl]methylideneamino]-1,4,5,6-tetrahydropyrimidin-2-amine.
| Compound Name | N-[(E)-[2-[(E)-(1,4,5,6-tetrahydropyrimidin-2-ylhydrazinylidene)methyl]imidazo[1,2-a]pyridin-6-yl]methylideneamino]-1,4,5,6-tetrahydropyrimidin-2-amine |
|---|---|
| PubChem CID | 10570921 |
| Molecular Formula | C17H22N10 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | N-[(E)-[2-[(E)-(1,4,5,6-tetrahydropyrimidin-2-ylhydrazinylidene)methyl]imidazo[1,2-a]pyridin-6-yl]methylideneamino]-1,4,5,6-tetrahydropyrimidin-2-amine |
| SMILES | C(=N/NC1=NCCCN1)\c1ccc2nc(/C=N/NC3=NCCCN3)cn2c1 |
| InChI | InChI=1S/C17H22N10/c1-5-18-16(19-6-1)25-22-9-13-3-4-15-24-14(12-27(15)11-13)10-23-26-17-20-7-2-8-21-17/h3-4,9-12H,1-2,5-8H2,(H2,18,19,25)(H2,20,21,26)/b22-9+,23-10+ |
| InChIKey | TVAJPNYGKMYCRW-HHAMRVRLSA-N |
| XLogP | -0.12 |
| TPSA | 114.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|