C21H34O5 — CID 10570942
(4R,5R,7S,8S,11R)-4-(1,3-dioxolan-2-ylmethyl)-11-methyl-8-propan-2-yl-6,13-dioxadispiro[4.1.57.35]pentadecan-14-one (PubChem CID 10570942) has the molecular formula C21H34O5 and a molecular weight of 366.50 g/mol. Its IUPAC name is (4R,5R,7S,8S,11R)-4-(1,3-dioxolan-2-ylmethyl)-11-methyl-8-propan-2-yl-6,13-dioxadispiro[4.1.57.35]pentadecan-14-one.
| Compound Name | (4R,5R,7S,8S,11R)-4-(1,3-dioxolan-2-ylmethyl)-11-methyl-8-propan-2-yl-6,13-dioxadispiro[4.1.57.35]pentadecan-14-one |
|---|---|
| PubChem CID | 10570942 |
| Molecular Formula | C21H34O5 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | (4R,5R,7S,8S,11R)-4-(1,3-dioxolan-2-ylmethyl)-11-methyl-8-propan-2-yl-6,13-dioxadispiro[4.1.57.35]pentadecan-14-one |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@]12OC(=O)C[C@@]1(CCC[C@@H]1CC1OCCO1)O2 |
| InChI | InChI=1S/C21H34O5/c1-14(2)17-7-6-15(3)12-21(17)25-18(22)13-20(26-21)8-4-5-16(20)11-19-23-9-10-24-19/h14-17,19H,4-13H2,1-3H3/t15-,16-,17+,20-,21-/m1/s1 |
| InChIKey | VIXIMUDVOJCGSZ-IJERAIBMSA-N |
| XLogP | 4.04 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |