C15H24F3NO2SSi — CID 10570998
N-[(2R)-3-methyl-1-trimethylsilyloxybutan-2-yl]-4-(trifluoromethyl)benzenesulfinamide (PubChem CID 10570998) has the molecular formula C15H24F3NO2SSi and a molecular weight of 367.51 g/mol. Its IUPAC name is N-[(2R)-3-methyl-1-trimethylsilyloxybutan-2-yl]-4-(trifluoromethyl)benzenesulfinamide.
| Compound Name | N-[(2R)-3-methyl-1-trimethylsilyloxybutan-2-yl]-4-(trifluoromethyl)benzenesulfinamide |
|---|---|
| PubChem CID | 10570998 |
| Molecular Formula | C15H24F3NO2SSi |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | N-[(2R)-3-methyl-1-trimethylsilyloxybutan-2-yl]-4-(trifluoromethyl)benzenesulfinamide |
| SMILES | CC(C)[C@H](CO[Si](C)(C)C)NS(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H24F3NO2SSi/c1-11(2)14(10-21-23(3,4)5)19-22(20)13-8-6-12(7-9-13)15(16,17)18/h6-9,11,14,19H,10H2,1-5H3/t14-,22?/m0/s1 |
| InChIKey | BSKKBPOFWMBMDE-XLEXHMCLSA-N |
| XLogP | 4.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|