C22H33N5 — CID 10571004
2-N-(cyclopropylmethyl)-6-methyl-2-N-pentyl-4-N-(2,4,6-trimethylphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 10571004) has the molecular formula C22H33N5 and a molecular weight of 367.54 g/mol. Its IUPAC name is 2-N-(cyclopropylmethyl)-6-methyl-2-N-pentyl-4-N-(2,4,6-trimethylphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(cyclopropylmethyl)-6-methyl-2-N-pentyl-4-N-(2,4,6-trimethylphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 10571004 |
| Molecular Formula | C22H33N5 |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.27 |
| IUPAC Name | 2-N-(cyclopropylmethyl)-6-methyl-2-N-pentyl-4-N-(2,4,6-trimethylphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCCN(CC1CC1)c1nc(C)nc(Nc2c(C)cc(C)cc2C)n1 |
| InChI | InChI=1S/C22H33N5/c1-6-7-8-11-27(14-19-9-10-19)22-24-18(5)23-21(26-22)25-20-16(3)12-15(2)13-17(20)4/h12-13,19H,6-11,14H2,1-5H3,(H,23,24,25,26) |
| InChIKey | SNTQKLUOXMLIBB-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|