C20H34O6 — CID 10571204
(2S,5S)-2-[(E,1R)-1-(methoxymethoxy)but-2-enyl]-5-[(2S,5S)-5-[(E,1R)-1-(methoxymethoxy)but-2-enyl]oxolan-2-yl]oxolane (PubChem CID 10571204) has the molecular formula C20H34O6 and a molecular weight of 370.49 g/mol. Its IUPAC name is (2S,5S)-2-[(E,1R)-1-(methoxymethoxy)but-2-enyl]-5-[(2S,5S)-5-[(E,1R)-1-(methoxymethoxy)but-2-enyl]oxolan-2-yl]oxolane.
| Compound Name | (2S,5S)-2-[(E,1R)-1-(methoxymethoxy)but-2-enyl]-5-[(2S,5S)-5-[(E,1R)-1-(methoxymethoxy)but-2-enyl]oxolan-2-yl]oxolane |
|---|---|
| PubChem CID | 10571204 |
| Molecular Formula | C20H34O6 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | (2S,5S)-2-[(E,1R)-1-(methoxymethoxy)but-2-enyl]-5-[(2S,5S)-5-[(E,1R)-1-(methoxymethoxy)but-2-enyl]oxolan-2-yl]oxolane |
| SMILES | C/C=C/[C@@H](OCOC)[C@@H]1CC[C@@H]([C@@H]2CC[C@@H]([C@@H](/C=C/C)OCOC)O2)O1 |
| InChI | InChI=1S/C20H34O6/c1-5-7-15(23-13-21-3)17-9-11-19(25-17)20-12-10-18(26-20)16(8-6-2)24-14-22-4/h5-8,15-20H,9-14H2,1-4H3/b7-5+,8-6+/t15-,16-,17+,18+,19+,20+/m1/s1 |
| InChIKey | OLCJCFKAQZSIAU-VVLNIIBISA-N |
| XLogP | 3.21 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|