C15H34O4S2Si — CID 10571231
(2R,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-1,1-bis(ethylsulfanyl)pentane-2,3,4-triol (PubChem CID 10571231) has the molecular formula C15H34O4S2Si and a molecular weight of 370.65 g/mol. Its IUPAC name is (2R,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-1,1-bis(ethylsulfanyl)pentane-2,3,4-triol.
| Compound Name | (2R,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-1,1-bis(ethylsulfanyl)pentane-2,3,4-triol |
|---|---|
| PubChem CID | 10571231 |
| Molecular Formula | C15H34O4S2Si |
| Molecular Weight | 370.65 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | (2R,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-1,1-bis(ethylsulfanyl)pentane-2,3,4-triol |
| SMILES | CCSC(SCC)[C@H](O)[C@@H](O)[C@H](O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H34O4S2Si/c1-8-20-14(21-9-2)13(18)12(17)11(16)10-19-22(6,7)15(3,4)5/h11-14,16-18H,8-10H2,1-7H3/t11-,12+,13-/m1/s1 |
| InChIKey | BHCHVFDGGRDYNS-FRRDWIJNSA-N |
| XLogP | 2.92 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.65 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|