C22H24N4O2 — CID 10571573
3,6,14,17-tetrazapentacyclo[17.3.1.13,6.18,12.114,17]hexacosa-1(23),8(25),9,11,19,21-hexaene-24,26-dione (PubChem CID 10571573) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 3,6,14,17-tetrazapentacyclo[17.3.1.13,6.18,12.114,17]hexacosa-1(23),8(25),9,11,19,21-hexaene-24,26-dione.
| Compound Name | 3,6,14,17-tetrazapentacyclo[17.3.1.13,6.18,12.114,17]hexacosa-1(23),8(25),9,11,19,21-hexaene-24,26-dione |
|---|---|
| PubChem CID | 10571573 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 3,6,14,17-tetrazapentacyclo[17.3.1.13,6.18,12.114,17]hexacosa-1(23),8(25),9,11,19,21-hexaene-24,26-dione |
| SMILES | O=C1N2CCN1Cc1cccc(c1)CN1CCN(Cc3cccc(c3)C2)C1=O |
| InChI | InChI=1S/C22H24N4O2/c27-21-23-7-9-25(21)15-19-5-2-6-20(12-19)16-26-10-8-24(22(26)28)14-18-4-1-3-17(11-18)13-23/h1-6,11-12H,7-10,13-16H2 |
| InChIKey | NVVORACPNOMJNM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |