About tert-butyl-[(1S,3Z)-3-(1-iodoethylidene)-2-methylidenecyclohexyl]oxy-dimethylsilane
tert-butyl-[(1S,3Z)-3-(1-iodoethylidene)-2-methylidenecyclohexyl]oxy-dimethylsilane (PubChem CID 10571671) has the molecular formula C15H27IOSi
and a molecular weight of 378.37 g/mol. Its IUPAC name is tert-butyl-[(1S,3Z)-3-(1-iodoethylidene)-2-methylidenecyclohexyl]oxy-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[(1S,3Z)-3-(1-iodoethylidene)-2-methylidenecyclohexyl]oxy-dimethylsilane |
| PubChem CID | 10571671 |
| Molecular Formula | C15H27IOSi |
| Molecular Weight | 378.37 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | tert-butyl-[(1S,3Z)-3-(1-iodoethylidene)-2-methylidenecyclohexyl]oxy-dimethylsilane |
| SMILES | C=C1/C(=C(/C)I)CCC[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H27IOSi/c1-11-13(12(2)16)9-8-10-14(11)17-18(6,7)15(3,4)5/h14H,1,8-10H2,2-7H3/b13-12-/t14-/m0/s1 |
| InChIKey | PSHSRJREXNNHHC-DINCDJDBSA-N |
| XLogP | 5.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.37 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[(1S,3Z)-3-(1-iodoethylidene)-2-methylidenecyclohexyl]oxy-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(1S,3Z)-3-(1-iodoethylidene)-2-methylidenecyclohexyl]oxy-dimethylsilane?
The IUPAC name of tert-butyl-[(1S,3Z)-3-(1-iodoethylidene)-2-methylidenecyclohexyl]oxy-dimethylsilane (CID 10571671) is tert-butyl-[(1S,3Z)-3-(1-iodoethylidene)-2-methylidenecyclohexyl]oxy-dimethylsilane.
What is the SMILES notation for tert-butyl-[(1S,3Z)-3-(1-iodoethylidene)-2-methylidenecyclohexyl]oxy-dimethylsilane?
The canonical SMILES for tert-butyl-[(1S,3Z)-3-(1-iodoethylidene)-2-methylidenecyclohexyl]oxy-dimethylsilane is C=C1/C(=C(/C)I)CCC[C@@H]1O[Si](C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl-[(1S,3Z)-3-(1-iodoethylidene)-2-methylidenecyclohexyl]oxy-dimethylsilane?
The InChIKey is PSHSRJREXNNHHC-DINCDJDBSA-N. The full InChI is InChI=1S/C15H27IOSi/c1-11-13(12(2)16)9-8-10-14(11)17-18(6,7)15(3,4)5/h14H,1,8-10H2,2-7H3/b13-12-/t14-/m0/s1.
What are the key properties of tert-butyl-[(1S,3Z)-3-(1-iodoethylidene)-2-methylidenecyclohexyl]oxy-dimethylsilane?
tert-butyl-[(1S,3Z)-3-(1-iodoethylidene)-2-methylidenecyclohexyl]oxy-dimethylsilane has a molecular weight of 378.37 g/mol, XLogP of 5.83, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(1S,3Z)-3-(1-iodoethylidene)-2-methylidenecyclohexyl]oxy-dimethylsilane is sourced from PubChem (CID 10571671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).