C21H23N3O4 — CID 10571886
ethyl N-(N-[(3R,4S)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]anilino)carbamate (PubChem CID 10571886) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is ethyl N-(N-[(3R,4S)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]anilino)carbamate.
| Compound Name | ethyl N-(N-[(3R,4S)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]anilino)carbamate |
|---|---|
| PubChem CID | 10571886 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | ethyl N-(N-[(3R,4S)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]anilino)carbamate |
| SMILES | CCOC(=O)NN(c1ccccc1)[C@H]1c2cc(C#N)ccc2OC(C)(C)[C@@H]1O |
| InChI | InChI=1S/C21H23N3O4/c1-4-27-20(26)23-24(15-8-6-5-7-9-15)18-16-12-14(13-22)10-11-17(16)28-21(2,3)19(18)25/h5-12,18-19,25H,4H2,1-3H3,(H,23,26)/t18-,19+/m0/s1 |
| InChIKey | LVRIGXGKVZETGN-RBUKOAKNSA-N |
| XLogP | 3.30 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|