C19H18N4O3S — CID 10571956
5-[[4-[2-(3-methylimidazo[4,5-b]pyridin-2-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 10571956) has the molecular formula C19H18N4O3S and a molecular weight of 382.45 g/mol. Its IUPAC name is 5-[[4-[2-(3-methylimidazo[4,5-b]pyridin-2-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[2-(3-methylimidazo[4,5-b]pyridin-2-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 10571956 |
| Molecular Formula | C19H18N4O3S |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 5-[[4-[2-(3-methylimidazo[4,5-b]pyridin-2-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | Cn1c(CCOc2ccc(CC3SC(=O)NC3=O)cc2)nc2cccnc21 |
| InChI | InChI=1S/C19H18N4O3S/c1-23-16(21-14-3-2-9-20-17(14)23)8-10-26-13-6-4-12(5-7-13)11-15-18(24)22-19(25)27-15/h2-7,9,15H,8,10-11H2,1H3,(H,22,24,25) |
| InChIKey | UMPQVFXUVKKTHO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|