C22H29NO5 — CID 10572291
(1R,5S,6R,16R)-5,6-dimethyl-6-phenylmethoxy-2,8-dioxa-13-azatricyclo[8.5.1.013,16]hexadecane-3,7-dione (PubChem CID 10572291) has the molecular formula C22H29NO5 and a molecular weight of 387.48 g/mol. Its IUPAC name is (1R,5S,6R,16R)-5,6-dimethyl-6-phenylmethoxy-2,8-dioxa-13-azatricyclo[8.5.1.013,16]hexadecane-3,7-dione.
| Compound Name | (1R,5S,6R,16R)-5,6-dimethyl-6-phenylmethoxy-2,8-dioxa-13-azatricyclo[8.5.1.013,16]hexadecane-3,7-dione |
|---|---|
| PubChem CID | 10572291 |
| Molecular Formula | C22H29NO5 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | (1R,5S,6R,16R)-5,6-dimethyl-6-phenylmethoxy-2,8-dioxa-13-azatricyclo[8.5.1.013,16]hexadecane-3,7-dione |
| SMILES | C[C@H]1CC(=O)O[C@@H]2CCN3CCC(COC(=O)[C@]1(C)OCc1ccccc1)[C@H]23 |
| InChI | InChI=1S/C22H29NO5/c1-15-12-19(24)28-18-9-11-23-10-8-17(20(18)23)14-26-21(25)22(15,2)27-13-16-6-4-3-5-7-16/h3-7,15,17-18,20H,8-14H2,1-2H3/t15-,17?,18+,20+,22+/m0/s1 |
| InChIKey | LCNPKRKJAWTVHU-RPUYZDEMSA-N |
| XLogP | 2.55 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |