C19H23N3O6 — CID 10572406
ethyl (1S,2S,4R)-7-benzyl-2-hydroxy-4-methyl-5,8-dioxo-3-oxa-6,7,9-triazatricyclo[7.3.0.02,6]dodecane-4-carboxylate (PubChem CID 10572406) has the molecular formula C19H23N3O6 and a molecular weight of 389.41 g/mol. Its IUPAC name is ethyl (1S,2S,4R)-7-benzyl-2-hydroxy-4-methyl-5,8-dioxo-3-oxa-6,7,9-triazatricyclo[7.3.0.02,6]dodecane-4-carboxylate.
| Compound Name | ethyl (1S,2S,4R)-7-benzyl-2-hydroxy-4-methyl-5,8-dioxo-3-oxa-6,7,9-triazatricyclo[7.3.0.02,6]dodecane-4-carboxylate |
|---|---|
| PubChem CID | 10572406 |
| Molecular Formula | C19H23N3O6 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | ethyl (1S,2S,4R)-7-benzyl-2-hydroxy-4-methyl-5,8-dioxo-3-oxa-6,7,9-triazatricyclo[7.3.0.02,6]dodecane-4-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)O[C@@]2(O)[C@@H]3CCCN3C(=O)N(Cc3ccccc3)N2C1=O |
| InChI | InChI=1S/C19H23N3O6/c1-3-27-16(24)18(2)15(23)22-19(26,28-18)14-10-7-11-20(14)17(25)21(22)12-13-8-5-4-6-9-13/h4-6,8-9,14,26H,3,7,10-12H2,1-2H3/t14-,18+,19-/m0/s1 |
| InChIKey | JMCJCFYGYAVTPB-KYNGSXCRSA-N |
| XLogP | 0.83 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|