C22H35N3OS — CID 10572440
2,2,5,5-tetramethyl-3-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one (PubChem CID 10572440) has the molecular formula C22H35N3OS and a molecular weight of 389.61 g/mol. Its IUPAC name is 2,2,5,5-tetramethyl-3-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one.
| Compound Name | 2,2,5,5-tetramethyl-3-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 10572440 |
| Molecular Formula | C22H35N3OS |
| Molecular Weight | 389.61 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | 2,2,5,5-tetramethyl-3-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one |
| SMILES | Cc1cccc(N2CCN(CCCCN3C(=O)C(C)(C)SC3(C)C)CC2)c1 |
| InChI | InChI=1S/C22H35N3OS/c1-18-9-8-10-19(17-18)24-15-13-23(14-16-24)11-6-7-12-25-20(26)21(2,3)27-22(25,4)5/h8-10,17H,6-7,11-16H2,1-5H3 |
| InChIKey | NXIBWRISYQVGKI-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.61 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|