C18H24BrN5 — CID 10572455
2-N-(2-bromo-4-propan-2-ylphenyl)-2-N-ethyl-6-methyl-4-N-prop-2-enyl-1,3,5-triazine-2,4-diamine (PubChem CID 10572455) has the molecular formula C18H24BrN5 and a molecular weight of 390.33 g/mol. Its IUPAC name is 2-N-(2-bromo-4-propan-2-ylphenyl)-2-N-ethyl-6-methyl-4-N-prop-2-enyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(2-bromo-4-propan-2-ylphenyl)-2-N-ethyl-6-methyl-4-N-prop-2-enyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 10572455 |
| Molecular Formula | C18H24BrN5 |
| Molecular Weight | 390.33 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 2-N-(2-bromo-4-propan-2-ylphenyl)-2-N-ethyl-6-methyl-4-N-prop-2-enyl-1,3,5-triazine-2,4-diamine |
| SMILES | C=CCNc1nc(C)nc(N(CC)c2ccc(C(C)C)cc2Br)n1 |
| InChI | InChI=1S/C18H24BrN5/c1-6-10-20-17-21-13(5)22-18(23-17)24(7-2)16-9-8-14(12(3)4)11-15(16)19/h6,8-9,11-12H,1,7,10H2,2-5H3,(H,20,21,22,23) |
| InChIKey | LWHQWVIVVJUSMB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.33 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|