C23H22N2O2S — CID 10572486
O-(6-phenylpyrrolo[2,1-d][1,5]benzoxazepin-7-yl) N,N-diethylcarbamothioate (PubChem CID 10572486) has the molecular formula C23H22N2O2S and a molecular weight of 390.51 g/mol. Its IUPAC name is O-(6-phenylpyrrolo[2,1-d][1,5]benzoxazepin-7-yl) N,N-diethylcarbamothioate.
| Compound Name | O-(6-phenylpyrrolo[2,1-d][1,5]benzoxazepin-7-yl) N,N-diethylcarbamothioate |
|---|---|
| PubChem CID | 10572486 |
| Molecular Formula | C23H22N2O2S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | O-(6-phenylpyrrolo[2,1-d][1,5]benzoxazepin-7-yl) N,N-diethylcarbamothioate |
| SMILES | CCN(CC)C(=S)OC1=C(c2ccccc2)Oc2ccccc2-n2cccc21 |
| InChI | InChI=1S/C23H22N2O2S/c1-3-24(4-2)23(28)27-22-19-14-10-16-25(19)18-13-8-9-15-20(18)26-21(22)17-11-6-5-7-12-17/h5-16H,3-4H2,1-2H3 |
| InChIKey | LBVSZQDASUWNMZ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 26.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|