C22H32O4S — CID 10572613
methyl 2-[(2S,3S,4R)-4-methyl-2-octyl-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate (PubChem CID 10572613) has the molecular formula C22H32O4S and a molecular weight of 392.56 g/mol. Its IUPAC name is methyl 2-[(2S,3S,4R)-4-methyl-2-octyl-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate.
| Compound Name | methyl 2-[(2S,3S,4R)-4-methyl-2-octyl-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate |
|---|---|
| PubChem CID | 10572613 |
| Molecular Formula | C22H32O4S |
| Molecular Weight | 392.56 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | methyl 2-[(2S,3S,4R)-4-methyl-2-octyl-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate |
| SMILES | CCCCCCCC[C@@H]1OC(=O)[C@](C)(Sc2ccccc2)[C@H]1CC(=O)OC |
| InChI | InChI=1S/C22H32O4S/c1-4-5-6-7-8-12-15-19-18(16-20(23)25-3)22(2,21(24)26-19)27-17-13-10-9-11-14-17/h9-11,13-14,18-19H,4-8,12,15-16H2,1-3H3/t18-,19-,22+/m0/s1 |
| InChIKey | VBABRJLMNWZFGC-CNNODRBYSA-N |
| XLogP | 5.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.56 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|