C16H25BrO6 — CID 10572627
diethyl 2-(2-bromoprop-2-enyl)-2-[[(4S,5S)-4,5-dimethyl-1,3-dioxolan-2-yl]methyl]propanedioate (PubChem CID 10572627) has the molecular formula C16H25BrO6 and a molecular weight of 393.27 g/mol. Its IUPAC name is diethyl 2-(2-bromoprop-2-enyl)-2-[[(4S,5S)-4,5-dimethyl-1,3-dioxolan-2-yl]methyl]propanedioate.
| Compound Name | diethyl 2-(2-bromoprop-2-enyl)-2-[[(4S,5S)-4,5-dimethyl-1,3-dioxolan-2-yl]methyl]propanedioate |
|---|---|
| PubChem CID | 10572627 |
| Molecular Formula | C16H25BrO6 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | diethyl 2-(2-bromoprop-2-enyl)-2-[[(4S,5S)-4,5-dimethyl-1,3-dioxolan-2-yl]methyl]propanedioate |
| SMILES | C=C(Br)CC(CC1O[C@@H](C)[C@H](C)O1)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C16H25BrO6/c1-6-20-14(18)16(8-10(3)17,15(19)21-7-2)9-13-22-11(4)12(5)23-13/h11-13H,3,6-9H2,1-2,4-5H3/t11-,12-/m0/s1 |
| InChIKey | QNGLKEARXPDIAZ-RYUDHWBXSA-N |
| XLogP | 2.94 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|