C22H23N3O4 — CID 10572642
2-[2-[4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]ethyl]isoindole-1,3-dione (PubChem CID 10572642) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is 2-[2-[4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 10572642 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 2-[2-[4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCN1CCN(c2cccc3c2OCCO3)CC1 |
| InChI | InChI=1S/C22H23N3O4/c26-21-16-4-1-2-5-17(16)22(27)25(21)13-10-23-8-11-24(12-9-23)18-6-3-7-19-20(18)29-15-14-28-19/h1-7H,8-15H2 |
| InChIKey | SQGUDQSORCIZRK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|