C11H9F3N6O7 — CID 10572674
2,5-dimethyl-3-(trifluoromethyl)-1H-1,2,4-triazol-2-ium;2,4,6-trinitrophenolate (PubChem CID 10572674) has the molecular formula C11H9F3N6O7 and a molecular weight of 394.22 g/mol. Its IUPAC name is 2,5-dimethyl-3-(trifluoromethyl)-1H-1,2,4-triazol-2-ium;2,4,6-trinitrophenolate.
| Compound Name | 2,5-dimethyl-3-(trifluoromethyl)-1H-1,2,4-triazol-2-ium;2,4,6-trinitrophenolate |
|---|---|
| PubChem CID | 10572674 |
| Molecular Formula | C11H9F3N6O7 |
| Molecular Weight | 394.22 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 2,5-dimethyl-3-(trifluoromethyl)-1H-1,2,4-triazol-2-ium;2,4,6-trinitrophenolate |
| SMILES | Cc1nc(C(F)(F)F)[n+](C)[nH]1.O=[N+]([O-])c1cc([N+](=O)[O-])c([O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H3N3O7.C5H6F3N3/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;1-3-9-4(5(6,7)8)11(2)10-3/h1-2,10H;1-2H3 |
| InChIKey | OWDZDEODHGGHDF-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 185.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.22 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|