About [(2S,3S)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl] benzoate
[(2S,3S)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl] benzoate (PubChem CID 10572904) has the molecular formula C27H27NO2
and a molecular weight of 397.52 g/mol. Its IUPAC name is [(2S,3S)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl] benzoate.
Molecular Properties
| Compound Name | [(2S,3S)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl] benzoate |
| PubChem CID | 10572904 |
| Molecular Formula | C27H27NO2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | [(2S,3S)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl] benzoate |
| SMILES | O=C(O[C@H]1C2CCN(CC2)[C@H]1C(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H27NO2/c29-27(23-14-8-3-9-15-23)30-26-22-16-18-28(19-17-22)25(26)24(20-10-4-1-5-11-20)21-12-6-2-7-13-21/h1-15,22,24-26H,16-19H2/t25-,26-/m0/s1 |
| InChIKey | JMCHMBYLNMYYFC-UIOOFZCWSA-N |
| XLogP | 5.14 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S,3S)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3S)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl] benzoate?
The IUPAC name of [(2S,3S)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl] benzoate (CID 10572904) is [(2S,3S)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl] benzoate.
What is the SMILES notation for [(2S,3S)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl] benzoate?
The canonical SMILES for [(2S,3S)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl] benzoate is O=C(O[C@H]1C2CCN(CC2)[C@H]1C(c1ccccc1)c1ccccc1)c1ccccc1.
What is the InChIKey of [(2S,3S)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl] benzoate?
The InChIKey is JMCHMBYLNMYYFC-UIOOFZCWSA-N. The full InChI is InChI=1S/C27H27NO2/c29-27(23-14-8-3-9-15-23)30-26-22-16-18-28(19-17-22)25(26)24(20-10-4-1-5-11-20)21-12-6-2-7-13-21/h1-15,22,24-26H,16-19H2/t25-,26-/m0/s1.
What are the key properties of [(2S,3S)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl] benzoate?
[(2S,3S)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl] benzoate has a molecular weight of 397.52 g/mol, XLogP of 5.14, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3S)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl] benzoate is sourced from PubChem (CID 10572904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).