C23H34N4O2 — CID 10572962
2-[4-[4-(2-methylphenyl)piperazin-1-yl]butyl]-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazine-1,4-dione (PubChem CID 10572962) has the molecular formula C23H34N4O2 and a molecular weight of 398.55 g/mol. Its IUPAC name is 2-[4-[4-(2-methylphenyl)piperazin-1-yl]butyl]-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazine-1,4-dione.
| Compound Name | 2-[4-[4-(2-methylphenyl)piperazin-1-yl]butyl]-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 10572962 |
| Molecular Formula | C23H34N4O2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | 2-[4-[4-(2-methylphenyl)piperazin-1-yl]butyl]-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazine-1,4-dione |
| SMILES | Cc1ccccc1N1CCN(CCCCN2CC(=O)N3CCCCC3C2=O)CC1 |
| InChI | InChI=1S/C23H34N4O2/c1-19-8-2-3-9-20(19)25-16-14-24(15-17-25)11-6-7-12-26-18-22(28)27-13-5-4-10-21(27)23(26)29/h2-3,8-9,21H,4-7,10-18H2,1H3 |
| InChIKey | ACBRSXOTZHFOPE-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|