C29H26N2O — CID 1057302
N-[2-(1H-indol-3-yl)ethyl]-N-[(4-methylphenyl)methyl]naphthalene-1-carboxamide (PubChem CID 1057302) has the molecular formula C29H26N2O and a molecular weight of 418.54 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-N-[(4-methylphenyl)methyl]naphthalene-1-carboxamide.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-N-[(4-methylphenyl)methyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 1057302 |
| Molecular Formula | C29H26N2O |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-N-[(4-methylphenyl)methyl]naphthalene-1-carboxamide |
| SMILES | Cc1ccc(CN(CCc2c[nH]c3ccccc23)C(=O)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C29H26N2O/c1-21-13-15-22(16-14-21)20-31(18-17-24-19-30-28-12-5-4-10-26(24)28)29(32)27-11-6-8-23-7-2-3-9-25(23)27/h2-16,19,30H,17-18,20H2,1H3 |
| InChIKey | VFWGUIWJHNWSNE-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |