C15H17BrN2O4S — CID 10573104
propan-2-yl 4-(5-bromothiophen-2-yl)-2,6-dimethyl-5-nitro-1,4-dihydropyridine-3-carboxylate (PubChem CID 10573104) has the molecular formula C15H17BrN2O4S and a molecular weight of 401.28 g/mol. Its IUPAC name is propan-2-yl 4-(5-bromothiophen-2-yl)-2,6-dimethyl-5-nitro-1,4-dihydropyridine-3-carboxylate.
| Compound Name | propan-2-yl 4-(5-bromothiophen-2-yl)-2,6-dimethyl-5-nitro-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 10573104 |
| Molecular Formula | C15H17BrN2O4S |
| Molecular Weight | 401.28 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | propan-2-yl 4-(5-bromothiophen-2-yl)-2,6-dimethyl-5-nitro-1,4-dihydropyridine-3-carboxylate |
| SMILES | CC1=C(C(=O)OC(C)C)C(c2ccc(Br)s2)C([N+](=O)[O-])=C(C)N1 |
| InChI | InChI=1S/C15H17BrN2O4S/c1-7(2)22-15(19)12-8(3)17-9(4)14(18(20)21)13(12)10-5-6-11(16)23-10/h5-7,13,17H,1-4H3 |
| InChIKey | NUOWGFRHWDOUFJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.28 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|