C18H30O6S2 — CID 10573415
methyl (E,4R)-4-[(1R,2R,4S)-2-(1,3-dithian-2-yl)-4-hydroxycyclopentyl]-4-(2-methoxyethoxymethoxy)but-2-enoate (PubChem CID 10573415) has the molecular formula C18H30O6S2 and a molecular weight of 406.57 g/mol. Its IUPAC name is methyl (E,4R)-4-[(1R,2R,4S)-2-(1,3-dithian-2-yl)-4-hydroxycyclopentyl]-4-(2-methoxyethoxymethoxy)but-2-enoate.
| Compound Name | methyl (E,4R)-4-[(1R,2R,4S)-2-(1,3-dithian-2-yl)-4-hydroxycyclopentyl]-4-(2-methoxyethoxymethoxy)but-2-enoate |
|---|---|
| PubChem CID | 10573415 |
| Molecular Formula | C18H30O6S2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | methyl (E,4R)-4-[(1R,2R,4S)-2-(1,3-dithian-2-yl)-4-hydroxycyclopentyl]-4-(2-methoxyethoxymethoxy)but-2-enoate |
| SMILES | COCCOCO[C@H](/C=C/C(=O)OC)[C@@H]1C[C@H](O)C[C@H]1C1SCCCS1 |
| InChI | InChI=1S/C18H30O6S2/c1-21-6-7-23-12-24-16(4-5-17(20)22-2)14-10-13(19)11-15(14)18-25-8-3-9-26-18/h4-5,13-16,18-19H,3,6-12H2,1-2H3/b5-4+/t13-,14+,15+,16+/m0/s1 |
| InChIKey | VPXWXPQAIKGRAE-DMKVFIAPSA-N |
| XLogP | 2.30 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|