C17H16ClN3O5S — CID 10573591
5-[(4-amino-6-oxo-2-sulfanylidene-5H-pyrimidin-5-yl)-(2-chlorophenyl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 10573591) has the molecular formula C17H16ClN3O5S and a molecular weight of 409.85 g/mol. Its IUPAC name is 5-[(4-amino-6-oxo-2-sulfanylidene-5H-pyrimidin-5-yl)-(2-chlorophenyl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(4-amino-6-oxo-2-sulfanylidene-5H-pyrimidin-5-yl)-(2-chlorophenyl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 10573591 |
| Molecular Formula | C17H16ClN3O5S |
| Molecular Weight | 409.85 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | 5-[(4-amino-6-oxo-2-sulfanylidene-5H-pyrimidin-5-yl)-(2-chlorophenyl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(C(c2ccccc2Cl)C2C(=O)NC(=S)N=C2N)C(=O)O1 |
| InChI | InChI=1S/C17H16ClN3O5S/c1-17(2)25-14(23)11(15(24)26-17)9(7-5-3-4-6-8(7)18)10-12(19)20-16(27)21-13(10)22/h3-6,9-11H,1-2H3,(H3,19,20,21,22,27) |
| InChIKey | DAWQEIWICDPOOV-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.85 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|