C22H38O5Si — CID 10573643
methyl (1S,2S,3S,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-methoxy-7-methylidene-9-oxobicyclo[3.3.1]nonane-1-carboxylate (PubChem CID 10573643) has the molecular formula C22H38O5Si and a molecular weight of 410.63 g/mol. Its IUPAC name is methyl (1S,2S,3S,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-methoxy-7-methylidene-9-oxobicyclo[3.3.1]nonane-1-carboxylate.
| Compound Name | methyl (1S,2S,3S,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-methoxy-7-methylidene-9-oxobicyclo[3.3.1]nonane-1-carboxylate |
|---|---|
| PubChem CID | 10573643 |
| Molecular Formula | C22H38O5Si |
| Molecular Weight | 410.63 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | methyl (1S,2S,3S,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-methoxy-7-methylidene-9-oxobicyclo[3.3.1]nonane-1-carboxylate |
| SMILES | C=C1C[C@H]2C[C@H](OC)[C@@H](CCCO[Si](C)(C)C(C)(C)C)[C@@](C(=O)OC)(C1)C2=O |
| InChI | InChI=1S/C22H38O5Si/c1-15-12-16-13-18(25-5)17(22(14-15,19(16)23)20(24)26-6)10-9-11-27-28(7,8)21(2,3)4/h16-18H,1,9-14H2,2-8H3/t16-,17+,18-,22-/m0/s1 |
| InChIKey | JNSLAZPMSCCFMU-SUWCGCSTSA-N |
| XLogP | 4.52 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.63 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|