C19H20N6O5 — CID 10573716
(2S,3S,4R,5R)-5-(6-benzamidopurin-9-yl)-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide (PubChem CID 10573716) has the molecular formula C19H20N6O5 and a molecular weight of 412.41 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-(6-benzamidopurin-9-yl)-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-(6-benzamidopurin-9-yl)-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
|---|---|
| PubChem CID | 10573716 |
| Molecular Formula | C19H20N6O5 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | (2S,3S,4R,5R)-5-(6-benzamidopurin-9-yl)-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H20N6O5/c1-2-20-18(29)14-12(26)13(27)19(30-14)25-9-23-11-15(21-8-22-16(11)25)24-17(28)10-6-4-3-5-7-10/h3-9,12-14,19,26-27H,2H2,1H3,(H,20,29)(H,21,22,24,28)/t12-,13+,14-,19+/m0/s1 |
| InChIKey | QBLSLPHSICILCF-SSHHRWTQSA-N |
| XLogP | -0.17 |
| TPSA | 151.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |