C22H40O5Si — CID 10573744
methyl 3-[(1'S,3'aS,4'S,7'aS)-1'-[tert-butyl(dimethyl)silyl]oxy-7'a-methylspiro[1,3-dioxolane-2,5'-2,3,3a,4,6,7-hexahydro-1H-indene]-4'-yl]propanoate (PubChem CID 10573744) has the molecular formula C22H40O5Si and a molecular weight of 412.64 g/mol. Its IUPAC name is methyl 3-[(1'S,3'aS,4'S,7'aS)-1'-[tert-butyl(dimethyl)silyl]oxy-7'a-methylspiro[1,3-dioxolane-2,5'-2,3,3a,4,6,7-hexahydro-1H-indene]-4'-yl]propanoate.
| Compound Name | methyl 3-[(1'S,3'aS,4'S,7'aS)-1'-[tert-butyl(dimethyl)silyl]oxy-7'a-methylspiro[1,3-dioxolane-2,5'-2,3,3a,4,6,7-hexahydro-1H-indene]-4'-yl]propanoate |
|---|---|
| PubChem CID | 10573744 |
| Molecular Formula | C22H40O5Si |
| Molecular Weight | 412.64 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | methyl 3-[(1'S,3'aS,4'S,7'aS)-1'-[tert-butyl(dimethyl)silyl]oxy-7'a-methylspiro[1,3-dioxolane-2,5'-2,3,3a,4,6,7-hexahydro-1H-indene]-4'-yl]propanoate |
| SMILES | COC(=O)CC[C@H]1[C@@H]2CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@]2(C)CCC12OCCO2 |
| InChI | InChI=1S/C22H40O5Si/c1-20(2,3)28(6,7)27-18-10-8-16-17(9-11-19(23)24-5)22(25-14-15-26-22)13-12-21(16,18)4/h16-18H,8-15H2,1-7H3/t16-,17-,18-,21-/m0/s1 |
| InChIKey | GNUQNHFYGYMNRR-NTLWEQJWSA-N |
| XLogP | 4.90 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.64 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|