C25H36O3Si — CID 10573746
(8S,9S,10R,11S,13S,14S)-10,13-dimethyl-17-propanoyl-11-trimethylsilyloxy-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-one (PubChem CID 10573746) has the molecular formula C25H36O3Si and a molecular weight of 412.65 g/mol. Its IUPAC name is (8S,9S,10R,11S,13S,14S)-10,13-dimethyl-17-propanoyl-11-trimethylsilyloxy-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,11S,13S,14S)-10,13-dimethyl-17-propanoyl-11-trimethylsilyloxy-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 10573746 |
| Molecular Formula | C25H36O3Si |
| Molecular Weight | 412.65 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | (8S,9S,10R,11S,13S,14S)-10,13-dimethyl-17-propanoyl-11-trimethylsilyloxy-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CCC(=O)C1=CC[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C)C[C@]12C |
| InChI | InChI=1S/C25H36O3Si/c1-7-21(27)20-11-10-19-18-9-8-16-14-17(26)12-13-24(16,2)23(18)22(15-25(19,20)3)28-29(4,5)6/h11-14,18-19,22-23H,7-10,15H2,1-6H3/t18-,19-,22-,23+,24-,25-/m0/s1 |
| InChIKey | SHKWOQSWOVLSIL-RQDINUAWSA-N |
| XLogP | 5.64 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.65 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|