C24H37NO3Si — CID 10573911
[(1S,6S,8aS)-1-tri(propan-2-yl)silyloxy-1,2,3,5,6,8a-hexahydroindolizin-6-yl] benzoate (PubChem CID 10573911) has the molecular formula C24H37NO3Si and a molecular weight of 415.65 g/mol. Its IUPAC name is [(1S,6S,8aS)-1-tri(propan-2-yl)silyloxy-1,2,3,5,6,8a-hexahydroindolizin-6-yl] benzoate.
| Compound Name | [(1S,6S,8aS)-1-tri(propan-2-yl)silyloxy-1,2,3,5,6,8a-hexahydroindolizin-6-yl] benzoate |
|---|---|
| PubChem CID | 10573911 |
| Molecular Formula | C24H37NO3Si |
| Molecular Weight | 415.65 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | [(1S,6S,8aS)-1-tri(propan-2-yl)silyloxy-1,2,3,5,6,8a-hexahydroindolizin-6-yl] benzoate |
| SMILES | CC(C)[Si](O[C@H]1CCN2C[C@@H](OC(=O)c3ccccc3)C=C[C@@H]12)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H37NO3Si/c1-17(2)29(18(3)4,19(5)6)28-23-14-15-25-16-21(12-13-22(23)25)27-24(26)20-10-8-7-9-11-20/h7-13,17-19,21-23H,14-16H2,1-6H3/t21-,22-,23-/m0/s1 |
| InChIKey | PGHJZYAADVNAGI-VABKMULXSA-N |
| XLogP | 5.42 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.65 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|