C24H24N4O3 — CID 10573944
(2R,3R,4S,5R)-2-(4-anilino-2-methyl-5-phenylpyrrolo[2,3-d]pyrimidin-7-yl)-5-methyloxolane-3,4-diol (PubChem CID 10573944) has the molecular formula C24H24N4O3 and a molecular weight of 416.48 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(4-anilino-2-methyl-5-phenylpyrrolo[2,3-d]pyrimidin-7-yl)-5-methyloxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(4-anilino-2-methyl-5-phenylpyrrolo[2,3-d]pyrimidin-7-yl)-5-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 10573944 |
| Molecular Formula | C24H24N4O3 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | (2R,3R,4S,5R)-2-(4-anilino-2-methyl-5-phenylpyrrolo[2,3-d]pyrimidin-7-yl)-5-methyloxolane-3,4-diol |
| SMILES | Cc1nc(Nc2ccccc2)c2c(-c3ccccc3)cn([C@@H]3O[C@H](C)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C24H24N4O3/c1-14-20(29)21(30)24(31-14)28-13-18(16-9-5-3-6-10-16)19-22(25-15(2)26-23(19)28)27-17-11-7-4-8-12-17/h3-14,20-21,24,29-30H,1-2H3,(H,25,26,27)/t14-,20-,21-,24-/m1/s1 |
| InChIKey | QTALEPUVMQMVON-VPWKFZTBSA-N |
| XLogP | 3.79 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |