C24H38N2O4 — CID 10574062
4-[(3,4-dimethylphenyl)carbamoyl]-5-(dipentylamino)-5-oxopentanoic acid (PubChem CID 10574062) has the molecular formula C24H38N2O4 and a molecular weight of 418.58 g/mol. Its IUPAC name is 4-[(3,4-dimethylphenyl)carbamoyl]-5-(dipentylamino)-5-oxopentanoic acid.
| Compound Name | 4-[(3,4-dimethylphenyl)carbamoyl]-5-(dipentylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 10574062 |
| Molecular Formula | C24H38N2O4 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.28 |
| IUPAC Name | 4-[(3,4-dimethylphenyl)carbamoyl]-5-(dipentylamino)-5-oxopentanoic acid |
| SMILES | CCCCCN(CCCCC)C(=O)C(CCC(=O)O)C(=O)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C24H38N2O4/c1-5-7-9-15-26(16-10-8-6-2)24(30)21(13-14-22(27)28)23(29)25-20-12-11-18(3)19(4)17-20/h11-12,17,21H,5-10,13-16H2,1-4H3,(H,25,29)(H,27,28) |
| InChIKey | HZNFKPKILMIXOF-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|