C21H24O9 — CID 10574134
2-[[3-[2-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]phenyl]methoxy]acetic acid (PubChem CID 10574134) has the molecular formula C21H24O9 and a molecular weight of 420.41 g/mol. Its IUPAC name is 2-[[3-[2-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]phenyl]methoxy]acetic acid.
| Compound Name | 2-[[3-[2-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]phenyl]methoxy]acetic acid |
|---|---|
| PubChem CID | 10574134 |
| Molecular Formula | C21H24O9 |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 2-[[3-[2-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]phenyl]methoxy]acetic acid |
| SMILES | O=C(O)COCc1cccc(-c2ccccc2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)c1 |
| InChI | InChI=1S/C21H24O9/c22-9-16-18(25)19(26)20(27)21(30-16)29-15-7-2-1-6-14(15)13-5-3-4-12(8-13)10-28-11-17(23)24/h1-8,16,18-22,25-27H,9-11H2,(H,23,24)/t16-,18-,19+,20+,21+/m1/s1 |
| InChIKey | BVXMGRFHSZPZJV-TZMRYXNNSA-N |
| XLogP | 0.13 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |