C12H14N4O9S2 — CID 10574225
(2S,3R,5R)-3-methyl-3-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfonylmethyl]-4,4,7-trioxo-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 10574225) has the molecular formula C12H14N4O9S2 and a molecular weight of 422.40 g/mol. Its IUPAC name is (2S,3R,5R)-3-methyl-3-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfonylmethyl]-4,4,7-trioxo-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,3R,5R)-3-methyl-3-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfonylmethyl]-4,4,7-trioxo-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 10574225 |
| Molecular Formula | C12H14N4O9S2 |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 422.02 |
| IUPAC Name | (2S,3R,5R)-3-methyl-3-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfonylmethyl]-4,4,7-trioxo-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | Cn1[nH]c(=O)c(=O)nc1S(=O)(=O)C[C@@]1(C)[C@H](C(=O)O)N2C(=O)C[C@H]2S1(=O)=O |
| InChI | InChI=1S/C12H14N4O9S2/c1-12(4-26(22,23)11-13-8(18)9(19)14-15(11)2)7(10(20)21)16-5(17)3-6(16)27(12,24)25/h6-7H,3-4H2,1-2H3,(H,14,19)(H,20,21)/t6-,7+,12+/m1/s1 |
| InChIKey | AQTDKCVYLUPABJ-LTMDPNIMSA-N |
| XLogP | -3.56 |
| TPSA | 193.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | -3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|