C14H6F5N3O3S2 — CID 10574278
2,3,4,5,6-pentafluoro-N-(2-sulfamoyl-1,3-benzothiazol-6-yl)benzamide (PubChem CID 10574278) has the molecular formula C14H6F5N3O3S2 and a molecular weight of 423.34 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-(2-sulfamoyl-1,3-benzothiazol-6-yl)benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-(2-sulfamoyl-1,3-benzothiazol-6-yl)benzamide |
|---|---|
| PubChem CID | 10574278 |
| Molecular Formula | C14H6F5N3O3S2 |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 422.98 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-(2-sulfamoyl-1,3-benzothiazol-6-yl)benzamide |
| SMILES | NS(=O)(=O)c1nc2ccc(NC(=O)c3c(F)c(F)c(F)c(F)c3F)cc2s1 |
| InChI | InChI=1S/C14H6F5N3O3S2/c15-8-7(9(16)11(18)12(19)10(8)17)13(23)21-4-1-2-5-6(3-4)26-14(22-5)27(20,24)25/h1-3H,(H,21,23)(H2,20,24,25) |
| InChIKey | BMQWSLBNOKTRQB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|