C26H17NO5 — CID 10574284
4-oxo-2-[3-(quinolin-2-ylmethoxy)phenyl]chromene-8-carboxylic acid (PubChem CID 10574284) has the molecular formula C26H17NO5 and a molecular weight of 423.42 g/mol. Its IUPAC name is 4-oxo-2-[3-(quinolin-2-ylmethoxy)phenyl]chromene-8-carboxylic acid.
| Compound Name | 4-oxo-2-[3-(quinolin-2-ylmethoxy)phenyl]chromene-8-carboxylic acid |
|---|---|
| PubChem CID | 10574284 |
| Molecular Formula | C26H17NO5 |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 4-oxo-2-[3-(quinolin-2-ylmethoxy)phenyl]chromene-8-carboxylic acid |
| SMILES | O=C(O)c1cccc2c(=O)cc(-c3cccc(OCc4ccc5ccccc5n4)c3)oc12 |
| InChI | InChI=1S/C26H17NO5/c28-23-14-24(32-25-20(23)8-4-9-21(25)26(29)30)17-6-3-7-19(13-17)31-15-18-12-11-16-5-1-2-10-22(16)27-18/h1-14H,15H2,(H,29,30) |
| InChIKey | KHHUBZJYSQUQNW-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |