About 4-[6-(3,5-dichloro-4-methoxyphenyl)spiro[2.4]hept-5-en-5-yl]benzenesulfonamide
4-[6-(3,5-dichloro-4-methoxyphenyl)spiro[2.4]hept-5-en-5-yl]benzenesulfonamide (PubChem CID 10574324) has the molecular formula C20H19Cl2NO3S
and a molecular weight of 424.35 g/mol. Its IUPAC name is 4-[6-(3,5-dichloro-4-methoxyphenyl)spiro[2.4]hept-5-en-5-yl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[6-(3,5-dichloro-4-methoxyphenyl)spiro[2.4]hept-5-en-5-yl]benzenesulfonamide |
| PubChem CID | 10574324 |
| Molecular Formula | C20H19Cl2NO3S |
| Molecular Weight | 424.35 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | 4-[6-(3,5-dichloro-4-methoxyphenyl)spiro[2.4]hept-5-en-5-yl]benzenesulfonamide |
| SMILES | COc1c(Cl)cc(C2=C(c3ccc(S(N)(=O)=O)cc3)CC3(CC3)C2)cc1Cl |
| InChI | InChI=1S/C20H19Cl2NO3S/c1-26-19-17(21)8-13(9-18(19)22)16-11-20(6-7-20)10-15(16)12-2-4-14(5-3-12)27(23,24)25/h2-5,8-9H,6-7,10-11H2,1H3,(H2,23,24,25) |
| InChIKey | MBABADMQCLGYMQ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.35 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4-[6-(3,5-dichloro-4-methoxyphenyl)spiro[2.4]hept-5-en-5-yl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[6-(3,5-dichloro-4-methoxyphenyl)spiro[2.4]hept-5-en-5-yl]benzenesulfonamide?
The IUPAC name of 4-[6-(3,5-dichloro-4-methoxyphenyl)spiro[2.4]hept-5-en-5-yl]benzenesulfonamide (CID 10574324) is 4-[6-(3,5-dichloro-4-methoxyphenyl)spiro[2.4]hept-5-en-5-yl]benzenesulfonamide.
What is the SMILES notation for 4-[6-(3,5-dichloro-4-methoxyphenyl)spiro[2.4]hept-5-en-5-yl]benzenesulfonamide?
The canonical SMILES for 4-[6-(3,5-dichloro-4-methoxyphenyl)spiro[2.4]hept-5-en-5-yl]benzenesulfonamide is COc1c(Cl)cc(C2=C(c3ccc(S(N)(=O)=O)cc3)CC3(CC3)C2)cc1Cl.
What is the InChIKey of 4-[6-(3,5-dichloro-4-methoxyphenyl)spiro[2.4]hept-5-en-5-yl]benzenesulfonamide?
The InChIKey is MBABADMQCLGYMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19Cl2NO3S/c1-26-19-17(21)8-13(9-18(19)22)16-11-20(6-7-20)10-15(16)12-2-4-14(5-3-12)27(23,24)25/h2-5,8-9H,6-7,10-11H2,1H3,(H2,23,24,25).
What are the key properties of 4-[6-(3,5-dichloro-4-methoxyphenyl)spiro[2.4]hept-5-en-5-yl]benzenesulfonamide?
4-[6-(3,5-dichloro-4-methoxyphenyl)spiro[2.4]hept-5-en-5-yl]benzenesulfonamide has a molecular weight of 424.35 g/mol, XLogP of 5.13, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[6-(3,5-dichloro-4-methoxyphenyl)spiro[2.4]hept-5-en-5-yl]benzenesulfonamide is sourced from PubChem (CID 10574324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).