C22H46O4Si2 — CID 10574692
tert-butyl-[(2E,4S,5R,6E)-5-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)octa-2,6-dienoxy]-dimethylsilane (PubChem CID 10574692) has the molecular formula C22H46O4Si2 and a molecular weight of 430.78 g/mol. Its IUPAC name is tert-butyl-[(2E,4S,5R,6E)-5-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)octa-2,6-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2E,4S,5R,6E)-5-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)octa-2,6-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10574692 |
| Molecular Formula | C22H46O4Si2 |
| Molecular Weight | 430.78 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | tert-butyl-[(2E,4S,5R,6E)-5-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)octa-2,6-dienoxy]-dimethylsilane |
| SMILES | C/C=C/[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](/C=C/CO[Si](C)(C)C(C)(C)C)OCOC |
| InChI | InChI=1S/C22H46O4Si2/c1-13-15-20(26-28(11,12)22(5,6)7)19(24-18-23-8)16-14-17-25-27(9,10)21(2,3)4/h13-16,19-20H,17-18H2,1-12H3/b15-13+,16-14+/t19-,20+/m0/s1 |
| InChIKey | FQYDIDNMUNOVBW-GWSMZIFCSA-N |
| XLogP | 6.52 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.78 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|