C20H25N5O4S — CID 10574717
2-[4-[[4-(4-carbamimidoylphenyl)-1,3-thiazol-2-yl]amino]piperidin-1-yl]-4-methoxy-4-oxobutanoic acid (PubChem CID 10574717) has the molecular formula C20H25N5O4S and a molecular weight of 431.52 g/mol. Its IUPAC name is 2-[4-[[4-(4-carbamimidoylphenyl)-1,3-thiazol-2-yl]amino]piperidin-1-yl]-4-methoxy-4-oxobutanoic acid.
| Compound Name | 2-[4-[[4-(4-carbamimidoylphenyl)-1,3-thiazol-2-yl]amino]piperidin-1-yl]-4-methoxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 10574717 |
| Molecular Formula | C20H25N5O4S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 2-[4-[[4-(4-carbamimidoylphenyl)-1,3-thiazol-2-yl]amino]piperidin-1-yl]-4-methoxy-4-oxobutanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(-c2csc(NC3CCN(C(CC(=O)OC)C(=O)O)CC3)n2)cc1 |
| InChI | InChI=1S/C20H25N5O4S/c1-29-17(26)10-16(19(27)28)25-8-6-14(7-9-25)23-20-24-15(11-30-20)12-2-4-13(5-3-12)18(21)22/h2-5,11,14,16H,6-10H2,1H3,(H3,21,22)(H,23,24)(H,27,28) |
| InChIKey | OZAJBBZJZBUQOI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 141.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|