C27H48O2Si — CID 10574779
(5S,7S,7aS)-5-[(5R)-5-[(2S)-4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]-2-methylcyclopenten-1-yl]-3,7-dimethyl-1,2,4,6,7,7a-hexahydroinden-5-ol (PubChem CID 10574779) has the molecular formula C27H48O2Si and a molecular weight of 432.77 g/mol. Its IUPAC name is (5S,7S,7aS)-5-[(5R)-5-[(2S)-4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]-2-methylcyclopenten-1-yl]-3,7-dimethyl-1,2,4,6,7,7a-hexahydroinden-5-ol.
| Compound Name | (5S,7S,7aS)-5-[(5R)-5-[(2S)-4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]-2-methylcyclopenten-1-yl]-3,7-dimethyl-1,2,4,6,7,7a-hexahydroinden-5-ol |
|---|---|
| PubChem CID | 10574779 |
| Molecular Formula | C27H48O2Si |
| Molecular Weight | 432.77 g/mol |
| Exact Mass | 432.34 |
| IUPAC Name | (5S,7S,7aS)-5-[(5R)-5-[(2S)-4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]-2-methylcyclopenten-1-yl]-3,7-dimethyl-1,2,4,6,7,7a-hexahydroinden-5-ol |
| SMILES | CC1=C2C[C@](O)(C3=C(C)CC[C@@H]3[C@@H](C)CCO[Si](C)(C)C(C)(C)C)C[C@H](C)[C@@H]2CC1 |
| InChI | InChI=1S/C27H48O2Si/c1-18-10-12-22-21(4)16-27(28,17-24(18)22)25-20(3)11-13-23(25)19(2)14-15-29-30(8,9)26(5,6)7/h19,21-23,28H,10-17H2,1-9H3/t19-,21-,22-,23+,27-/m0/s1 |
| InChIKey | CMDCXHIGSUPCDY-CYPMEJCNSA-N |
| XLogP | 7.65 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.77 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|