C25H22N6S — CID 10575019
6-(4-methylpiperazin-1-yl)-11,13-diphenyl-8-thia-3,4,5,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 10575019) has the molecular formula C25H22N6S and a molecular weight of 438.56 g/mol. Its IUPAC name is 6-(4-methylpiperazin-1-yl)-11,13-diphenyl-8-thia-3,4,5,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 6-(4-methylpiperazin-1-yl)-11,13-diphenyl-8-thia-3,4,5,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 10575019 |
| Molecular Formula | C25H22N6S |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 6-(4-methylpiperazin-1-yl)-11,13-diphenyl-8-thia-3,4,5,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | CN1CCN(c2nnnc3c2sc2nc(-c4ccccc4)cc(-c4ccccc4)c23)CC1 |
| InChI | InChI=1S/C25H22N6S/c1-30-12-14-31(15-13-30)24-23-22(27-29-28-24)21-19(17-8-4-2-5-9-17)16-20(26-25(21)32-23)18-10-6-3-7-11-18/h2-11,16H,12-15H2,1H3 |
| InChIKey | KGNGCSICZKYHRQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |