About 4-chlorobenzenesulfonate;ethyl-methyl-phenyltellanium
4-chlorobenzenesulfonate;ethyl-methyl-phenyltellanium (PubChem CID 10575097) has the molecular formula C15H17ClO3STe
and a molecular weight of 440.42 g/mol. Its IUPAC name is 4-chlorobenzenesulfonate;ethyl-methyl-phenyltellanium.
Molecular Properties
| Compound Name | 4-chlorobenzenesulfonate;ethyl-methyl-phenyltellanium |
| PubChem CID | 10575097 |
| Molecular Formula | C15H17ClO3STe |
| Molecular Weight | 440.42 g/mol |
| Exact Mass | 441.96 |
| IUPAC Name | 4-chlorobenzenesulfonate;ethyl-methyl-phenyltellanium |
| SMILES | CC[Te+](C)c1ccccc1.O=S(=O)([O-])c1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H13Te.C6H5ClO3S/c1-3-10(2)9-7-5-4-6-8-9;7-5-1-3-6(4-2-5)11(8,9)10/h4-8H,3H2,1-2H3;1-4H,(H,8,9,10)/q+1;/p-1 |
| InChIKey | ZEQWCHCWGXSBRU-UHFFFAOYSA-M |
| XLogP | 3.28 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-chlorobenzenesulfonate;ethyl-methyl-phenyltellanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chlorobenzenesulfonate;ethyl-methyl-phenyltellanium?
The IUPAC name of 4-chlorobenzenesulfonate;ethyl-methyl-phenyltellanium (CID 10575097) is 4-chlorobenzenesulfonate;ethyl-methyl-phenyltellanium.
What is the SMILES notation for 4-chlorobenzenesulfonate;ethyl-methyl-phenyltellanium?
The canonical SMILES for 4-chlorobenzenesulfonate;ethyl-methyl-phenyltellanium is CC[Te+](C)c1ccccc1.O=S(=O)([O-])c1ccc(Cl)cc1.
What is the InChIKey of 4-chlorobenzenesulfonate;ethyl-methyl-phenyltellanium?
The InChIKey is ZEQWCHCWGXSBRU-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H13Te.C6H5ClO3S/c1-3-10(2)9-7-5-4-6-8-9;7-5-1-3-6(4-2-5)11(8,9)10/h4-8H,3H2,1-2H3;1-4H,(H,8,9,10)/q+1;/p-1.
What are the key properties of 4-chlorobenzenesulfonate;ethyl-methyl-phenyltellanium?
4-chlorobenzenesulfonate;ethyl-methyl-phenyltellanium has a molecular weight of 440.42 g/mol, XLogP of 3.28, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chlorobenzenesulfonate;ethyl-methyl-phenyltellanium is sourced from PubChem (CID 10575097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).