About 4-[5-(3,5-dichloro-4-methoxyphenyl)-3-(difluoromethyl)pyrazol-1-yl]benzenesulfonamide
4-[5-(3,5-dichloro-4-methoxyphenyl)-3-(difluoromethyl)pyrazol-1-yl]benzenesulfonamide (PubChem CID 10575436) has the molecular formula C17H13Cl2F2N3O3S
and a molecular weight of 448.28 g/mol. Its IUPAC name is 4-[5-(3,5-dichloro-4-methoxyphenyl)-3-(difluoromethyl)pyrazol-1-yl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[5-(3,5-dichloro-4-methoxyphenyl)-3-(difluoromethyl)pyrazol-1-yl]benzenesulfonamide |
| PubChem CID | 10575436 |
| Molecular Formula | C17H13Cl2F2N3O3S |
| Molecular Weight | 448.28 g/mol |
| Exact Mass | 447.00 |
| IUPAC Name | 4-[5-(3,5-dichloro-4-methoxyphenyl)-3-(difluoromethyl)pyrazol-1-yl]benzenesulfonamide |
| SMILES | COc1c(Cl)cc(-c2cc(C(F)F)nn2-c2ccc(S(N)(=O)=O)cc2)cc1Cl |
| InChI | InChI=1S/C17H13Cl2F2N3O3S/c1-27-16-12(18)6-9(7-13(16)19)15-8-14(17(20)21)23-24(15)10-2-4-11(5-3-10)28(22,25)26/h2-8,17H,1H3,(H2,22,25,26) |
| InChIKey | ATGNWRJVESLUOP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.28 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[5-(3,5-dichloro-4-methoxyphenyl)-3-(difluoromethyl)pyrazol-1-yl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(3,5-dichloro-4-methoxyphenyl)-3-(difluoromethyl)pyrazol-1-yl]benzenesulfonamide?
The IUPAC name of 4-[5-(3,5-dichloro-4-methoxyphenyl)-3-(difluoromethyl)pyrazol-1-yl]benzenesulfonamide (CID 10575436) is 4-[5-(3,5-dichloro-4-methoxyphenyl)-3-(difluoromethyl)pyrazol-1-yl]benzenesulfonamide.
What is the SMILES notation for 4-[5-(3,5-dichloro-4-methoxyphenyl)-3-(difluoromethyl)pyrazol-1-yl]benzenesulfonamide?
The canonical SMILES for 4-[5-(3,5-dichloro-4-methoxyphenyl)-3-(difluoromethyl)pyrazol-1-yl]benzenesulfonamide is COc1c(Cl)cc(-c2cc(C(F)F)nn2-c2ccc(S(N)(=O)=O)cc2)cc1Cl.
What is the InChIKey of 4-[5-(3,5-dichloro-4-methoxyphenyl)-3-(difluoromethyl)pyrazol-1-yl]benzenesulfonamide?
The InChIKey is ATGNWRJVESLUOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13Cl2F2N3O3S/c1-27-16-12(18)6-9(7-13(16)19)15-8-14(17(20)21)23-24(15)10-2-4-11(5-3-10)28(22,25)26/h2-8,17H,1H3,(H2,22,25,26).
What are the key properties of 4-[5-(3,5-dichloro-4-methoxyphenyl)-3-(difluoromethyl)pyrazol-1-yl]benzenesulfonamide?
4-[5-(3,5-dichloro-4-methoxyphenyl)-3-(difluoromethyl)pyrazol-1-yl]benzenesulfonamide has a molecular weight of 448.28 g/mol, XLogP of 4.44, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(3,5-dichloro-4-methoxyphenyl)-3-(difluoromethyl)pyrazol-1-yl]benzenesulfonamide is sourced from PubChem (CID 10575436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).