C21H25ClN4OS2 — CID 10575471
2-[3-[4-(2-chlorophenyl)piperazin-1-yl]propylsulfanyl]-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 10575471) has the molecular formula C21H25ClN4OS2 and a molecular weight of 449.05 g/mol. Its IUPAC name is 2-[3-[4-(2-chlorophenyl)piperazin-1-yl]propylsulfanyl]-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[3-[4-(2-chlorophenyl)piperazin-1-yl]propylsulfanyl]-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 10575471 |
| Molecular Formula | C21H25ClN4OS2 |
| Molecular Weight | 449.05 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 2-[3-[4-(2-chlorophenyl)piperazin-1-yl]propylsulfanyl]-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1sc2nc(SCCCN3CCN(c4ccccc4Cl)CC3)[nH]c(=O)c2c1C |
| InChI | InChI=1S/C21H25ClN4OS2/c1-14-15(2)29-20-18(14)19(27)23-21(24-20)28-13-5-8-25-9-11-26(12-10-25)17-7-4-3-6-16(17)22/h3-4,6-7H,5,8-13H2,1-2H3,(H,23,24,27) |
| InChIKey | QHHGYNKBCBHEBR-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.05 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|