C20H26FN5O6 — CID 10575581
(2S)-2-(butoxycarbonylamino)-3-[[2-[3-(4-carbamimidoyl-2-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]propanoic acid (PubChem CID 10575581) has the molecular formula C20H26FN5O6 and a molecular weight of 451.46 g/mol. Its IUPAC name is (2S)-2-(butoxycarbonylamino)-3-[[2-[3-(4-carbamimidoyl-2-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]propanoic acid.
| Compound Name | (2S)-2-(butoxycarbonylamino)-3-[[2-[3-(4-carbamimidoyl-2-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 10575581 |
| Molecular Formula | C20H26FN5O6 |
| Molecular Weight | 451.46 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | (2S)-2-(butoxycarbonylamino)-3-[[2-[3-(4-carbamimidoyl-2-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(C2=NOC(CC(=O)NC[C@H](NC(=O)OCCCC)C(=O)O)C2)c(F)c1 |
| InChI | InChI=1S/C20H26FN5O6/c1-2-3-6-31-20(30)25-16(19(28)29)10-24-17(27)9-12-8-15(26-32-12)13-5-4-11(18(22)23)7-14(13)21/h4-5,7,12,16H,2-3,6,8-10H2,1H3,(H3,22,23)(H,24,27)(H,25,30)(H,28,29)/t12?,16-/m0/s1 |
| InChIKey | GNKIPHNEAKLXNY-INSVYWFGSA-N |
| XLogP | 1.09 |
| TPSA | 176.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.46 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|