C24H25NO8 — CID 10575728
dimethyl 8,8-dimethoxy-4-phenylmethoxy-7,9-dihydrofuro[3,2-f]quinoline-2,6-dicarboxylate (PubChem CID 10575728) has the molecular formula C24H25NO8 and a molecular weight of 455.46 g/mol. Its IUPAC name is dimethyl 8,8-dimethoxy-4-phenylmethoxy-7,9-dihydrofuro[3,2-f]quinoline-2,6-dicarboxylate.
| Compound Name | dimethyl 8,8-dimethoxy-4-phenylmethoxy-7,9-dihydrofuro[3,2-f]quinoline-2,6-dicarboxylate |
|---|---|
| PubChem CID | 10575728 |
| Molecular Formula | C24H25NO8 |
| Molecular Weight | 455.46 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | dimethyl 8,8-dimethoxy-4-phenylmethoxy-7,9-dihydrofuro[3,2-f]quinoline-2,6-dicarboxylate |
| SMILES | COC(=O)c1cc2c3c(cc(OCc4ccccc4)c2o1)N(C(=O)OC)CC(OC)(OC)C3 |
| InChI | InChI=1S/C24H25NO8/c1-28-22(26)20-10-16-17-12-24(30-3,31-4)14-25(23(27)29-2)18(17)11-19(21(16)33-20)32-13-15-8-6-5-7-9-15/h5-11H,12-14H2,1-4H3 |
| InChIKey | NWIZSCGVQQJGKG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 96.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|